C28H32N2O3S — CID 3202675
2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(4-ethoxyphenyl)acetamide (PubChem CID 3202675) has the molecular formula C28H32N2O3S and a molecular weight of 476.64 g/mol. Its IUPAC name is 2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3202675 |
| Molecular Formula | C28H32N2O3S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(C(C(=O)NC2CCCC2)N(Cc2ccccc2)C(=O)Cc2cccs2)cc1 |
| InChI | InChI=1S/C28H32N2O3S/c1-2-33-24-16-14-22(15-17-24)27(28(32)29-23-11-6-7-12-23)30(20-21-9-4-3-5-10-21)26(31)19-25-13-8-18-34-25/h3-5,8-10,13-18,23,27H,2,6-7,11-12,19-20H2,1H3,(H,29,32) |
| InChIKey | RDKZMTVNAZEMNN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |