C25H28N2O3S — CID 3202445
2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(5-methylfuran-2-yl)acetamide (PubChem CID 3202445) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(5-methylfuran-2-yl)acetamide.
| Compound Name | 2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(5-methylfuran-2-yl)acetamide |
|---|---|
| PubChem CID | 3202445 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(5-methylfuran-2-yl)acetamide |
| SMILES | Cc1ccc(C(C(=O)NC2CCCC2)N(Cc2ccccc2)C(=O)Cc2cccs2)o1 |
| InChI | InChI=1S/C25H28N2O3S/c1-18-13-14-22(30-18)24(25(29)26-20-10-5-6-11-20)27(17-19-8-3-2-4-9-19)23(28)16-21-12-7-15-31-21/h2-4,7-9,12-15,20,24H,5-6,10-11,16-17H2,1H3,(H,26,29) |
| InChIKey | VTHVXAJITGRBEX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |