C26H29N3O2S — CID 3191114
2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclohexyl-2-pyridin-4-ylacetamide (PubChem CID 3191114) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is 2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclohexyl-2-pyridin-4-ylacetamide.
| Compound Name | 2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclohexyl-2-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 3191114 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[benzyl-(2-thiophen-2-ylacetyl)amino]-N-cyclohexyl-2-pyridin-4-ylacetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccncc1)N(Cc1ccccc1)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C26H29N3O2S/c30-24(18-23-12-7-17-32-23)29(19-20-8-3-1-4-9-20)25(21-13-15-27-16-14-21)26(31)28-22-10-5-2-6-11-22/h1,3-4,7-9,12-17,22,25H,2,5-6,10-11,18-19H2,(H,28,31) |
| InChIKey | VEPCDZIJVZTCSV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |