C24H25N3O2S — CID 3202613
N-cyclopentyl-2-pyridin-4-yl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide (PubChem CID 3202613) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-cyclopentyl-2-pyridin-4-yl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide.
| Compound Name | N-cyclopentyl-2-pyridin-4-yl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
|---|---|
| PubChem CID | 3202613 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-cyclopentyl-2-pyridin-4-yl-2-(N-(2-thiophen-2-ylacetyl)anilino)acetamide |
| SMILES | O=C(NC1CCCC1)C(c1ccncc1)N(C(=O)Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O2S/c28-22(17-21-11-6-16-30-21)27(20-9-2-1-3-10-20)23(18-12-14-25-15-13-18)24(29)26-19-7-4-5-8-19/h1-3,6,9-16,19,23H,4-5,7-8,17H2,(H,26,29) |
| InChIKey | MEXHEPBBKXQOKS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |