C28H30N2O3S — CID 3202898
2-(3-acetyl-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclopentyl-2-(4-methylphenyl)acetamide (PubChem CID 3202898) has the molecular formula C28H30N2O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is 2-(3-acetyl-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclopentyl-2-(4-methylphenyl)acetamide.
| Compound Name | 2-(3-acetyl-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclopentyl-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3202898 |
| Molecular Formula | C28H30N2O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-(3-acetyl-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclopentyl-2-(4-methylphenyl)acetamide |
| SMILES | CC(=O)c1cccc(N(C(=O)Cc2cccs2)C(C(=O)NC2CCCC2)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C28H30N2O3S/c1-19-12-14-21(15-13-19)27(28(33)29-23-8-3-4-9-23)30(26(32)18-25-11-6-16-34-25)24-10-5-7-22(17-24)20(2)31/h5-7,10-17,23,27H,3-4,8-9,18H2,1-2H3,(H,29,33) |
| InChIKey | WTWINQOLHWHNLE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |