C29H32N2O4S — CID 3191007
2-(4-acetyl-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclohexyl-2-(3-methoxyphenyl)acetamide (PubChem CID 3191007) has the molecular formula C29H32N2O4S and a molecular weight of 504.65 g/mol. Its IUPAC name is 2-(4-acetyl-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclohexyl-2-(3-methoxyphenyl)acetamide.
| Compound Name | 2-(4-acetyl-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclohexyl-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3191007 |
| Molecular Formula | C29H32N2O4S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 2-(4-acetyl-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclohexyl-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(C(C(=O)NC2CCCCC2)N(C(=O)Cc2cccs2)c2ccc(C(C)=O)cc2)c1 |
| InChI | InChI=1S/C29H32N2O4S/c1-20(32)21-13-15-24(16-14-21)31(27(33)19-26-12-7-17-36-26)28(22-8-6-11-25(18-22)35-2)29(34)30-23-9-4-3-5-10-23/h6-8,11-18,23,28H,3-5,9-10,19H2,1-2H3,(H,30,34) |
| InChIKey | ZRVRYOMGUIOSBL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |