C27H30N2O4S — CID 3202705
N-cyclopentyl-2-(3-methoxyphenyl)-2-(3-methoxy-N-(2-thiophen-2-ylacetyl)anilino)acetamide (PubChem CID 3202705) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is N-cyclopentyl-2-(3-methoxyphenyl)-2-(3-methoxy-N-(2-thiophen-2-ylacetyl)anilino)acetamide.
| Compound Name | N-cyclopentyl-2-(3-methoxyphenyl)-2-(3-methoxy-N-(2-thiophen-2-ylacetyl)anilino)acetamide |
|---|---|
| PubChem CID | 3202705 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-cyclopentyl-2-(3-methoxyphenyl)-2-(3-methoxy-N-(2-thiophen-2-ylacetyl)anilino)acetamide |
| SMILES | COc1cccc(C(C(=O)NC2CCCC2)N(C(=O)Cc2cccs2)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C27H30N2O4S/c1-32-22-12-5-8-19(16-22)26(27(31)28-20-9-3-4-10-20)29(21-11-6-13-23(17-21)33-2)25(30)18-24-14-7-15-34-24/h5-8,11-17,20,26H,3-4,9-10,18H2,1-2H3,(H,28,31) |
| InChIKey | LARXFBADMYNZDP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |