C22H30N2O3S — CID 3751458
2-[butyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(5-methylfuran-2-yl)acetamide (PubChem CID 3751458) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-[butyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(5-methylfuran-2-yl)acetamide.
| Compound Name | 2-[butyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(5-methylfuran-2-yl)acetamide |
|---|---|
| PubChem CID | 3751458 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2-[butyl-(2-thiophen-2-ylacetyl)amino]-N-cyclopentyl-2-(5-methylfuran-2-yl)acetamide |
| SMILES | CCCCN(C(=O)Cc1cccs1)C(C(=O)NC1CCCC1)c1ccc(C)o1 |
| InChI | InChI=1S/C22H30N2O3S/c1-3-4-13-24(20(25)15-18-10-7-14-28-18)21(19-12-11-16(2)27-19)22(26)23-17-8-5-6-9-17/h7,10-12,14,17,21H,3-6,8-9,13,15H2,1-2H3,(H,23,26) |
| InChIKey | RSARSYVSINLLET-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |