C26H36N2O5S — CID 3202615
N-cyclopentyl-2-(2,5-dimethoxyphenyl)-2-[3-ethoxypropyl-(2-thiophen-2-ylacetyl)amino]acetamide (PubChem CID 3202615) has the molecular formula C26H36N2O5S and a molecular weight of 488.65 g/mol. Its IUPAC name is N-cyclopentyl-2-(2,5-dimethoxyphenyl)-2-[3-ethoxypropyl-(2-thiophen-2-ylacetyl)amino]acetamide.
| Compound Name | N-cyclopentyl-2-(2,5-dimethoxyphenyl)-2-[3-ethoxypropyl-(2-thiophen-2-ylacetyl)amino]acetamide |
|---|---|
| PubChem CID | 3202615 |
| Molecular Formula | C26H36N2O5S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-cyclopentyl-2-(2,5-dimethoxyphenyl)-2-[3-ethoxypropyl-(2-thiophen-2-ylacetyl)amino]acetamide |
| SMILES | CCOCCCN(C(=O)Cc1cccs1)C(C(=O)NC1CCCC1)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C26H36N2O5S/c1-4-33-15-8-14-28(24(29)18-21-11-7-16-34-21)25(26(30)27-19-9-5-6-10-19)22-17-20(31-2)12-13-23(22)32-3/h7,11-13,16-17,19,25H,4-6,8-10,14-15,18H2,1-3H3,(H,27,30) |
| InChIKey | RZEMXASJFDFPKG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|