C26H36N2O5S — CID 3202329
N-[2-(cyclohexylamino)-1-(2,4-dimethoxyphenyl)-2-oxoethyl]-N-(3-ethoxypropyl)thiophene-2-carboxamide (PubChem CID 3202329) has the molecular formula C26H36N2O5S and a molecular weight of 488.65 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-1-(2,4-dimethoxyphenyl)-2-oxoethyl]-N-(3-ethoxypropyl)thiophene-2-carboxamide.
| Compound Name | N-[2-(cyclohexylamino)-1-(2,4-dimethoxyphenyl)-2-oxoethyl]-N-(3-ethoxypropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3202329 |
| Molecular Formula | C26H36N2O5S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-[2-(cyclohexylamino)-1-(2,4-dimethoxyphenyl)-2-oxoethyl]-N-(3-ethoxypropyl)thiophene-2-carboxamide |
| SMILES | CCOCCCN(C(=O)c1cccs1)C(C(=O)NC1CCCCC1)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C26H36N2O5S/c1-4-33-16-9-15-28(26(30)23-12-8-17-34-23)24(25(29)27-19-10-6-5-7-11-19)21-14-13-20(31-2)18-22(21)32-3/h8,12-14,17-19,24H,4-7,9-11,15-16H2,1-3H3,(H,27,29) |
| InChIKey | ABQWHHAHEGEBMQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|