C26H27FN2O2S — CID 3202828
N-cyclopentyl-2-(2-fluorophenyl)-2-(4-methyl-N-(2-thiophen-2-ylacetyl)anilino)acetamide (PubChem CID 3202828) has the molecular formula C26H27FN2O2S and a molecular weight of 450.58 g/mol. Its IUPAC name is N-cyclopentyl-2-(2-fluorophenyl)-2-(4-methyl-N-(2-thiophen-2-ylacetyl)anilino)acetamide.
| Compound Name | N-cyclopentyl-2-(2-fluorophenyl)-2-(4-methyl-N-(2-thiophen-2-ylacetyl)anilino)acetamide |
|---|---|
| PubChem CID | 3202828 |
| Molecular Formula | C26H27FN2O2S |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-cyclopentyl-2-(2-fluorophenyl)-2-(4-methyl-N-(2-thiophen-2-ylacetyl)anilino)acetamide |
| SMILES | Cc1ccc(N(C(=O)Cc2cccs2)C(C(=O)NC2CCCC2)c2ccccc2F)cc1 |
| InChI | InChI=1S/C26H27FN2O2S/c1-18-12-14-20(15-13-18)29(24(30)17-21-9-6-16-32-21)25(22-10-4-5-11-23(22)27)26(31)28-19-7-2-3-8-19/h4-6,9-16,19,25H,2-3,7-8,17H2,1H3,(H,28,31) |
| InChIKey | YVHBDIQQNPSHNT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |