C25H24F2N2O2S — CID 3202815
N-cyclopentyl-2-(2-fluorophenyl)-2-(2-fluoro-N-(2-thiophen-2-ylacetyl)anilino)acetamide (PubChem CID 3202815) has the molecular formula C25H24F2N2O2S and a molecular weight of 454.54 g/mol. Its IUPAC name is N-cyclopentyl-2-(2-fluorophenyl)-2-(2-fluoro-N-(2-thiophen-2-ylacetyl)anilino)acetamide.
| Compound Name | N-cyclopentyl-2-(2-fluorophenyl)-2-(2-fluoro-N-(2-thiophen-2-ylacetyl)anilino)acetamide |
|---|---|
| PubChem CID | 3202815 |
| Molecular Formula | C25H24F2N2O2S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-cyclopentyl-2-(2-fluorophenyl)-2-(2-fluoro-N-(2-thiophen-2-ylacetyl)anilino)acetamide |
| SMILES | O=C(NC1CCCC1)C(c1ccccc1F)N(C(=O)Cc1cccs1)c1ccccc1F |
| InChI | InChI=1S/C25H24F2N2O2S/c26-20-12-4-3-11-19(20)24(25(31)28-17-8-1-2-9-17)29(22-14-6-5-13-21(22)27)23(30)16-18-10-7-15-32-18/h3-7,10-15,17,24H,1-2,8-9,16H2,(H,28,31) |
| InChIKey | VJFCGRJLGPGYJX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |