C30H41ClN2O6 — CID 98364235
(2S)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cycloheptyl-2-(4-ethoxy-3-methoxyphenyl)acetamide (PubChem CID 98364235) has the molecular formula C30H41ClN2O6 and a molecular weight of 561.12 g/mol. Its IUPAC name is (2S)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cycloheptyl-2-(4-ethoxy-3-methoxyphenyl)acetamide.
| Compound Name | (2S)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cycloheptyl-2-(4-ethoxy-3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98364235 |
| Molecular Formula | C30H41ClN2O6 |
| Molecular Weight | 561.12 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | (2S)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cycloheptyl-2-(4-ethoxy-3-methoxyphenyl)acetamide |
| SMILES | CCOc1ccc([C@@H](C(=O)NC2CCCCCC2)N(CCc2ccc(OC)c(OC)c2)C(=O)CCl)cc1OC |
| InChI | InChI=1S/C30H41ClN2O6/c1-5-39-25-15-13-22(19-27(25)38-4)29(30(35)32-23-10-8-6-7-9-11-23)33(28(34)20-31)17-16-21-12-14-24(36-2)26(18-21)37-3/h12-15,18-19,23,29H,5-11,16-17,20H2,1-4H3,(H,32,35)/t29-/m0/s1 |
| InChIKey | CPLAXMPWNNFIPG-LJAQVGFWSA-N |
| XLogP | 5.30 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.12 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|