C31H43ClN2O6 — CID 98364266
(2R)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cycloheptyl-2-(3-methoxy-4-propoxyphenyl)acetamide (PubChem CID 98364266) has the molecular formula C31H43ClN2O6 and a molecular weight of 575.15 g/mol. Its IUPAC name is (2R)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cycloheptyl-2-(3-methoxy-4-propoxyphenyl)acetamide.
| Compound Name | (2R)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cycloheptyl-2-(3-methoxy-4-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98364266 |
| Molecular Formula | C31H43ClN2O6 |
| Molecular Weight | 575.15 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (2R)-2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cycloheptyl-2-(3-methoxy-4-propoxyphenyl)acetamide |
| SMILES | CCCOc1ccc([C@H](C(=O)NC2CCCCCC2)N(CCc2ccc(OC)c(OC)c2)C(=O)CCl)cc1OC |
| InChI | InChI=1S/C31H43ClN2O6/c1-5-18-40-26-15-13-23(20-28(26)39-4)30(31(36)33-24-10-8-6-7-9-11-24)34(29(35)21-32)17-16-22-12-14-25(37-2)27(19-22)38-3/h12-15,19-20,24,30H,5-11,16-18,21H2,1-4H3,(H,33,36)/t30-/m1/s1 |
| InChIKey | JYXJUPLDNGZVIW-SSEXGKCCSA-N |
| XLogP | 5.69 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.15 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|