C27H35ClN2O5 — CID 86810155
2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cyclohexyl-2-(3-methoxyphenyl)acetamide (PubChem CID 86810155) has the molecular formula C27H35ClN2O5 and a molecular weight of 503.04 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cyclohexyl-2-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cyclohexyl-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86810155 |
| Molecular Formula | C27H35ClN2O5 |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-[(2-chloroacetyl)-[2-(3,4-dimethoxyphenyl)ethyl]amino]-N-cyclohexyl-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(C(C(=O)NC2CCCCC2)N(CCc2ccc(OC)c(OC)c2)C(=O)CCl)c1 |
| InChI | InChI=1S/C27H35ClN2O5/c1-33-22-11-7-8-20(17-22)26(27(32)29-21-9-5-4-6-10-21)30(25(31)18-28)15-14-19-12-13-23(34-2)24(16-19)35-3/h7-8,11-13,16-17,21,26H,4-6,9-10,14-15,18H2,1-3H3,(H,29,32) |
| InChIKey | DIEWAIFUYBDPBH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|