C27H34Cl2N2O4 — CID 86810073
2-[(2-chloroacetyl)-[2-(4-chlorophenyl)ethyl]amino]-N-cycloheptyl-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 86810073) has the molecular formula C27H34Cl2N2O4 and a molecular weight of 521.49 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[2-(4-chlorophenyl)ethyl]amino]-N-cycloheptyl-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[2-(4-chlorophenyl)ethyl]amino]-N-cycloheptyl-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86810073 |
| Molecular Formula | C27H34Cl2N2O4 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 2-[(2-chloroacetyl)-[2-(4-chlorophenyl)ethyl]amino]-N-cycloheptyl-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(C(C(=O)NC2CCCCCC2)N(CCc2ccc(Cl)cc2)C(=O)CCl)cc1OC |
| InChI | InChI=1S/C27H34Cl2N2O4/c1-34-23-14-11-20(17-24(23)35-2)26(27(33)30-22-7-5-3-4-6-8-22)31(25(32)18-28)16-15-19-9-12-21(29)13-10-19/h9-14,17,22,26H,3-8,15-16,18H2,1-2H3,(H,30,33) |
| InChIKey | YNDPDPOHAJTTIC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|