C26H35ClN2O5 — CID 86810222
2-[(2-chloroacetyl)-(furan-2-ylmethyl)amino]-N-cycloheptyl-2-(3-methoxy-4-propoxyphenyl)acetamide (PubChem CID 86810222) has the molecular formula C26H35ClN2O5 and a molecular weight of 491.03 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-(furan-2-ylmethyl)amino]-N-cycloheptyl-2-(3-methoxy-4-propoxyphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-(furan-2-ylmethyl)amino]-N-cycloheptyl-2-(3-methoxy-4-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86810222 |
| Molecular Formula | C26H35ClN2O5 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-[(2-chloroacetyl)-(furan-2-ylmethyl)amino]-N-cycloheptyl-2-(3-methoxy-4-propoxyphenyl)acetamide |
| SMILES | CCCOc1ccc(C(C(=O)NC2CCCCCC2)N(Cc2ccco2)C(=O)CCl)cc1OC |
| InChI | InChI=1S/C26H35ClN2O5/c1-3-14-34-22-13-12-19(16-23(22)32-2)25(26(31)28-20-9-6-4-5-7-10-20)29(24(30)17-27)18-21-11-8-15-33-21/h8,11-13,15-16,20,25H,3-7,9-10,14,17-18H2,1-2H3,(H,28,31) |
| InChIKey | DRDRFBBRJPVZTM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|