C23H26ClFN2O2 — CID 4688312
2-[benzyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-fluorophenyl)acetamide (PubChem CID 4688312) has the molecular formula C23H26ClFN2O2 and a molecular weight of 416.92 g/mol. Its IUPAC name is 2-[benzyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-fluorophenyl)acetamide.
| Compound Name | 2-[benzyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 4688312 |
| Molecular Formula | C23H26ClFN2O2 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[benzyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccc(F)cc1)N(Cc1ccccc1)C(=O)CCl |
| InChI | InChI=1S/C23H26ClFN2O2/c24-15-21(28)27(16-17-7-3-1-4-8-17)22(18-11-13-19(25)14-12-18)23(29)26-20-9-5-2-6-10-20/h1,3-4,7-8,11-14,20,22H,2,5-6,9-10,15-16H2,(H,26,29) |
| InChIKey | VIGPMYPWZRHPDS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|