C29H39ClN2O3 — CID 86810164
2-[benzyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-hexoxyphenyl)acetamide (PubChem CID 86810164) has the molecular formula C29H39ClN2O3 and a molecular weight of 499.10 g/mol. Its IUPAC name is 2-[benzyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-hexoxyphenyl)acetamide.
| Compound Name | 2-[benzyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-hexoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86810164 |
| Molecular Formula | C29H39ClN2O3 |
| Molecular Weight | 499.10 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 2-[benzyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-hexoxyphenyl)acetamide |
| SMILES | CCCCCCOc1ccc(C(C(=O)NC2CCCCC2)N(Cc2ccccc2)C(=O)CCl)cc1 |
| InChI | InChI=1S/C29H39ClN2O3/c1-2-3-4-11-20-35-26-18-16-24(17-19-26)28(29(34)31-25-14-9-6-10-15-25)32(27(33)21-30)22-23-12-7-5-8-13-23/h5,7-8,12-13,16-19,25,28H,2-4,6,9-11,14-15,20-22H2,1H3,(H,31,34) |
| InChIKey | IOLYURIVQXJAQC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.10 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|