C31H41ClN2O5 — CID 98364376
(2S)-2-[(2-chloroacetyl)-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]amino]-N-cyclohexyl-2-(4-hexoxyphenyl)acetamide (PubChem CID 98364376) has the molecular formula C31H41ClN2O5 and a molecular weight of 557.13 g/mol. Its IUPAC name is (2S)-2-[(2-chloroacetyl)-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]amino]-N-cyclohexyl-2-(4-hexoxyphenyl)acetamide.
| Compound Name | (2S)-2-[(2-chloroacetyl)-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]amino]-N-cyclohexyl-2-(4-hexoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98364376 |
| Molecular Formula | C31H41ClN2O5 |
| Molecular Weight | 557.13 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | (2S)-2-[(2-chloroacetyl)-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]amino]-N-cyclohexyl-2-(4-hexoxyphenyl)acetamide |
| SMILES | CCCCCCOc1ccc([C@@H](C(=O)NC2CCCCC2)N(C[C@H]2COc3ccccc3O2)C(=O)CCl)cc1 |
| InChI | InChI=1S/C31H41ClN2O5/c1-2-3-4-10-19-37-25-17-15-23(16-18-25)30(31(36)33-24-11-6-5-7-12-24)34(29(35)20-32)21-26-22-38-27-13-8-9-14-28(27)39-26/h8-9,13-18,24,26,30H,2-7,10-12,19-22H2,1H3,(H,33,36)/t26-,30-/m0/s1 |
| InChIKey | UVQPJLAXEDGLPE-YZNIXAGQSA-N |
| XLogP | 6.04 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.13 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|