C27H29FN2O2S — CID 1457715
(2S)-2-[benzyl-(2-thiophen-3-ylacetyl)amino]-N-cyclohexyl-2-(4-fluorophenyl)acetamide (PubChem CID 1457715) has the molecular formula C27H29FN2O2S and a molecular weight of 464.61 g/mol. Its IUPAC name is (2S)-2-[benzyl-(2-thiophen-3-ylacetyl)amino]-N-cyclohexyl-2-(4-fluorophenyl)acetamide.
| Compound Name | (2S)-2-[benzyl-(2-thiophen-3-ylacetyl)amino]-N-cyclohexyl-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 1457715 |
| Molecular Formula | C27H29FN2O2S |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (2S)-2-[benzyl-(2-thiophen-3-ylacetyl)amino]-N-cyclohexyl-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(NC1CCCCC1)[C@H](c1ccc(F)cc1)N(Cc1ccccc1)C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C27H29FN2O2S/c28-23-13-11-22(12-14-23)26(27(32)29-24-9-5-2-6-10-24)30(18-20-7-3-1-4-8-20)25(31)17-21-15-16-33-19-21/h1,3-4,7-8,11-16,19,24,26H,2,5-6,9-10,17-18H2,(H,29,32)/t26-/m0/s1 |
| InChIKey | WCCKGZITUYYNHD-SANMLTNESA-N |
| XLogP | 5.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |