C22H24ClFN2O2 — CID 53364514
2-(N-(2-chloroacetyl)-4-fluoroanilino)-N-cyclohexyl-2-phenylacetamide (PubChem CID 53364514) has the molecular formula C22H24ClFN2O2 and a molecular weight of 402.90 g/mol. Its IUPAC name is 2-(N-(2-chloroacetyl)-4-fluoroanilino)-N-cyclohexyl-2-phenylacetamide.
| Compound Name | 2-(N-(2-chloroacetyl)-4-fluoroanilino)-N-cyclohexyl-2-phenylacetamide |
|---|---|
| PubChem CID | 53364514 |
| Molecular Formula | C22H24ClFN2O2 |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-(N-(2-chloroacetyl)-4-fluoroanilino)-N-cyclohexyl-2-phenylacetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccccc1)N(C(=O)CCl)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24ClFN2O2/c23-15-20(27)26(19-13-11-17(24)12-14-19)21(16-7-3-1-4-8-16)22(28)25-18-9-5-2-6-10-18/h1,3-4,7-8,11-14,18,21H,2,5-6,9-10,15H2,(H,25,28) |
| InChIKey | ZBYQCWGRXAISNW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|