C25H28ClFN2O4 — CID 4109390
2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-cycloheptyl-2-(4-fluorophenyl)acetamide (PubChem CID 4109390) has the molecular formula C25H28ClFN2O4 and a molecular weight of 474.96 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-cycloheptyl-2-(4-fluorophenyl)acetamide.
| Compound Name | 2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-cycloheptyl-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 4109390 |
| Molecular Formula | C25H28ClFN2O4 |
| Molecular Weight | 474.96 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-cycloheptyl-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(NC1CCCCCC1)C(c1ccc(F)cc1)N(Cc1ccc2c(c1)OCO2)C(=O)CCl |
| InChI | InChI=1S/C25H28ClFN2O4/c26-14-23(30)29(15-17-7-12-21-22(13-17)33-16-32-21)24(18-8-10-19(27)11-9-18)25(31)28-20-5-3-1-2-4-6-20/h7-13,20,24H,1-6,14-16H2,(H,28,31) |
| InChIKey | CQVJERHUHPHHDP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.96 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|