C26H31ClN2O4 — CID 86809967
2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-(4-methylcyclohexyl)-2-(4-methylphenyl)acetamide (PubChem CID 86809967) has the molecular formula C26H31ClN2O4 and a molecular weight of 471.00 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-(4-methylcyclohexyl)-2-(4-methylphenyl)acetamide.
| Compound Name | 2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-(4-methylcyclohexyl)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 86809967 |
| Molecular Formula | C26H31ClN2O4 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-(4-methylcyclohexyl)-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(C(=O)NC2CCC(C)CC2)N(Cc2ccc3c(c2)OCO3)C(=O)CCl)cc1 |
| InChI | InChI=1S/C26H31ClN2O4/c1-17-3-8-20(9-4-17)25(26(31)28-21-10-5-18(2)6-11-21)29(24(30)14-27)15-19-7-12-22-23(13-19)33-16-32-22/h3-4,7-9,12-13,18,21,25H,5-6,10-11,14-16H2,1-2H3,(H,28,31) |
| InChIKey | XGNDUBYGSHKAEI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|