C22H27ClN2O2S — CID 4642658
2-[(2-chloroacetyl)-(2-phenylethyl)amino]-N-cyclohexyl-2-thiophen-2-ylacetamide (PubChem CID 4642658) has the molecular formula C22H27ClN2O2S and a molecular weight of 418.99 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-(2-phenylethyl)amino]-N-cyclohexyl-2-thiophen-2-ylacetamide.
| Compound Name | 2-[(2-chloroacetyl)-(2-phenylethyl)amino]-N-cyclohexyl-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 4642658 |
| Molecular Formula | C22H27ClN2O2S |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[(2-chloroacetyl)-(2-phenylethyl)amino]-N-cyclohexyl-2-thiophen-2-ylacetamide |
| SMILES | O=C(NC1CCCCC1)C(c1cccs1)N(CCc1ccccc1)C(=O)CCl |
| InChI | InChI=1S/C22H27ClN2O2S/c23-16-20(26)25(14-13-17-8-3-1-4-9-17)21(19-12-7-15-28-19)22(27)24-18-10-5-2-6-11-18/h1,3-4,7-9,12,15,18,21H,2,5-6,10-11,13-14,16H2,(H,24,27) |
| InChIKey | VADJZTSEKSEBSG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|