C24H37ClN4O3 — CID 168791217
2-[(4-tert-butylmorpholin-2-yl)methyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-pyridin-3-ylacetamide (PubChem CID 168791217) has the molecular formula C24H37ClN4O3 and a molecular weight of 465.04 g/mol. Its IUPAC name is 2-[(4-tert-butylmorpholin-2-yl)methyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-pyridin-3-ylacetamide.
| Compound Name | 2-[(4-tert-butylmorpholin-2-yl)methyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 168791217 |
| Molecular Formula | C24H37ClN4O3 |
| Molecular Weight | 465.04 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 2-[(4-tert-butylmorpholin-2-yl)methyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-pyridin-3-ylacetamide |
| SMILES | CC(C)(C)N1CCOC(CN(C(=O)CCl)C(C(=O)NC2CCCCC2)c2cccnc2)C1 |
| InChI | InChI=1S/C24H37ClN4O3/c1-24(2,3)28-12-13-32-20(16-28)17-29(21(30)14-25)22(18-8-7-11-26-15-18)23(31)27-19-9-5-4-6-10-19/h7-8,11,15,19-20,22H,4-6,9-10,12-14,16-17H2,1-3H3,(H,27,31) |
| InChIKey | BDPSUCQRSHKAHW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.04 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|