C24H29ClN4O2 — CID 168791171
2-[(2-chloroacetyl)-(1-phenylazetidin-3-yl)amino]-N-cyclohexyl-2-pyridin-3-ylacetamide (PubChem CID 168791171) has the molecular formula C24H29ClN4O2 and a molecular weight of 440.98 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-(1-phenylazetidin-3-yl)amino]-N-cyclohexyl-2-pyridin-3-ylacetamide.
| Compound Name | 2-[(2-chloroacetyl)-(1-phenylazetidin-3-yl)amino]-N-cyclohexyl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 168791171 |
| Molecular Formula | C24H29ClN4O2 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-[(2-chloroacetyl)-(1-phenylazetidin-3-yl)amino]-N-cyclohexyl-2-pyridin-3-ylacetamide |
| SMILES | O=C(NC1CCCCC1)C(c1cccnc1)N(C(=O)CCl)C1CN(c2ccccc2)C1 |
| InChI | InChI=1S/C24H29ClN4O2/c25-14-22(30)29(21-16-28(17-21)20-11-5-2-6-12-20)23(18-8-7-13-26-15-18)24(31)27-19-9-3-1-4-10-19/h2,5-8,11-13,15,19,21,23H,1,3-4,9-10,14,16-17H2,(H,27,31) |
| InChIKey | HANSHQMCQLOZIT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|