C23H28ClN3O3 — CID 4642657
2-[(2-chloroacetyl)-[(2-methoxyphenyl)methyl]amino]-N-cyclohexyl-2-pyridin-3-ylacetamide (PubChem CID 4642657) has the molecular formula C23H28ClN3O3 and a molecular weight of 429.95 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[(2-methoxyphenyl)methyl]amino]-N-cyclohexyl-2-pyridin-3-ylacetamide.
| Compound Name | 2-[(2-chloroacetyl)-[(2-methoxyphenyl)methyl]amino]-N-cyclohexyl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 4642657 |
| Molecular Formula | C23H28ClN3O3 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-[(2-chloroacetyl)-[(2-methoxyphenyl)methyl]amino]-N-cyclohexyl-2-pyridin-3-ylacetamide |
| SMILES | COc1ccccc1CN(C(=O)CCl)C(C(=O)NC1CCCCC1)c1cccnc1 |
| InChI | InChI=1S/C23H28ClN3O3/c1-30-20-12-6-5-8-18(20)16-27(21(28)14-24)22(17-9-7-13-25-15-17)23(29)26-19-10-3-2-4-11-19/h5-9,12-13,15,19,22H,2-4,10-11,14,16H2,1H3,(H,26,29) |
| InChIKey | JYGHBJLBEXURKR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|