C26H33N3O — CID 168791167
2-(4-tert-butyl-N-prop-2-ynylanilino)-N-cyclohexyl-2-pyridin-3-ylacetamide (PubChem CID 168791167) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is 2-(4-tert-butyl-N-prop-2-ynylanilino)-N-cyclohexyl-2-pyridin-3-ylacetamide.
| Compound Name | 2-(4-tert-butyl-N-prop-2-ynylanilino)-N-cyclohexyl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 168791167 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 2-(4-tert-butyl-N-prop-2-ynylanilino)-N-cyclohexyl-2-pyridin-3-ylacetamide |
| SMILES | C#CCN(c1ccc(C(C)(C)C)cc1)C(C(=O)NC1CCCCC1)c1cccnc1 |
| InChI | InChI=1S/C26H33N3O/c1-5-18-29(23-15-13-21(14-16-23)26(2,3)4)24(20-10-9-17-27-19-20)25(30)28-22-11-7-6-8-12-22/h1,9-10,13-17,19,22,24H,6-8,11-12,18H2,2-4H3,(H,28,30) |
| InChIKey | MLTXZTVMTRXGBC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|