C27H37N7O3 — CID 156892617
3-amino-N'-(4-tert-butylphenyl)-N'-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-2-hydrazinylbut-2-enediamide (PubChem CID 156892617) has the molecular formula C27H37N7O3 and a molecular weight of 507.64 g/mol. Its IUPAC name is 3-amino-N'-(4-tert-butylphenyl)-N'-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-2-hydrazinylbut-2-enediamide.
| Compound Name | 3-amino-N'-(4-tert-butylphenyl)-N'-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-2-hydrazinylbut-2-enediamide |
|---|---|
| PubChem CID | 156892617 |
| Molecular Formula | C27H37N7O3 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | 3-amino-N'-(4-tert-butylphenyl)-N'-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-2-hydrazinylbut-2-enediamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)C(N)=C(NN)C(N)=O)C(C(=O)NC2CCCCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C27H37N7O3/c1-27(2,3)18-11-13-20(14-12-18)34(26(37)21(28)22(33-30)24(29)35)23(17-8-7-15-31-16-17)25(36)32-19-9-5-4-6-10-19/h7-8,11-16,19,23,33H,4-6,9-10,28,30H2,1-3H3,(H2,29,35)(H,32,36) |
| InChIKey | GPCFYAWSWOYKTE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 169.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|