C29H36FN5O2 — CID 166799377
(2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 166799377) has the molecular formula C29H36FN5O2 and a molecular weight of 505.64 g/mol. Its IUPAC name is (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166799377 |
| Molecular Formula | C29H36FN5O2 |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)[C@H]2C[C@@H](F)CN2C#N)[C@@H](C(=O)NC2CCCCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C29H36FN5O2/c1-29(2,3)21-11-13-24(14-12-21)35(28(37)25-16-22(30)18-34(25)19-31)26(20-8-7-15-32-17-20)27(36)33-23-9-5-4-6-10-23/h7-8,11-15,17,22-23,25-26H,4-6,9-10,16,18H2,1-3H3,(H,33,36)/t22-,25-,26-/m1/s1 |
| InChIKey | AVXYUNHPLZWLAN-DNRSQYFGSA-N |
| XLogP | 4.80 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|