C29H37N5O4 — CID 166040324
(3S,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-3,4-dihydroxypyrrolidine-2-carboxamide (PubChem CID 166040324) has the molecular formula C29H37N5O4 and a molecular weight of 519.65 g/mol. Its IUPAC name is (3S,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-3,4-dihydroxypyrrolidine-2-carboxamide.
| Compound Name | (3S,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-3,4-dihydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166040324 |
| Molecular Formula | C29H37N5O4 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | (3S,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-3,4-dihydroxypyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)C2[C@H](O)[C@H](O)CN2C#N)C(C(=O)NC2CCCCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C29H37N5O4/c1-29(2,3)20-11-13-22(14-12-20)34(28(38)25-26(36)23(35)17-33(25)18-30)24(19-8-7-15-31-16-19)27(37)32-21-9-5-4-6-10-21/h7-8,11-16,21,23-26,35-36H,4-6,9-10,17H2,1-3H3,(H,32,37)/t23-,24?,25?,26-/m1/s1 |
| InChIKey | VIPBTRUYOGWNIX-ZMVDSDSOSA-N |
| XLogP | 2.79 |
| TPSA | 129.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|