C28H31F4N5O3 — CID 167559529
(2R,4R)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-hydroxy-N-[4-(1,1,1,2-tetrafluoropropan-2-yl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 167559529) has the molecular formula C28H31F4N5O3 and a molecular weight of 561.58 g/mol. Its IUPAC name is (2R,4R)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-hydroxy-N-[4-(1,1,1,2-tetrafluoropropan-2-yl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-hydroxy-N-[4-(1,1,1,2-tetrafluoropropan-2-yl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167559529 |
| Molecular Formula | C28H31F4N5O3 |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | (2R,4R)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-hydroxy-N-[4-(1,1,1,2-tetrafluoropropan-2-yl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CC(F)(c1ccc(N(C(=O)[C@H]2C[C@@H](O)CN2C#N)C(C(=O)NC2CCCCC2)c2cccnc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C28H31F4N5O3/c1-27(29,28(30,31)32)19-9-11-21(12-10-19)37(26(40)23-14-22(38)16-36(23)17-33)24(18-6-5-13-34-15-18)25(39)35-20-7-3-2-4-8-20/h5-6,9-13,15,20,22-24,38H,2-4,7-8,14,16H2,1H3,(H,35,39)/t22-,23-,24?,27?/m1/s1 |
| InChIKey | DLRLKYJLUVJFHT-OYIQYMQASA-N |
| XLogP | 4.27 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|