C30H37F2N5O3 — CID 166040174
(2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-(difluoromethoxy)pyrrolidine-2-carboxamide (PubChem CID 166040174) has the molecular formula C30H37F2N5O3 and a molecular weight of 553.65 g/mol. Its IUPAC name is (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-(difluoromethoxy)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-(difluoromethoxy)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166040174 |
| Molecular Formula | C30H37F2N5O3 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | (2R,4R)-N-(4-tert-butylphenyl)-1-cyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-(difluoromethoxy)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)[C@H]2C[C@@H](OC(F)F)CN2C#N)C(C(=O)NC2CCCCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C30H37F2N5O3/c1-30(2,3)21-11-13-23(14-12-21)37(28(39)25-16-24(40-29(31)32)18-36(25)19-33)26(20-8-7-15-34-17-20)27(38)35-22-9-5-4-6-10-22/h7-8,11-15,17,22,24-26,29H,4-6,9-10,16,18H2,1-3H3,(H,35,38)/t24-,25-,26?/m1/s1 |
| InChIKey | AWFKQUURRWDOTN-YFHSQZFMSA-N |
| XLogP | 5.07 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|