C32H35N5O2 — CID 167604512
(2R,4R)-1-cyano-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-methyl-N-(4-phenylphenyl)pyrrolidine-2-carboxamide (PubChem CID 167604512) has the molecular formula C32H35N5O2 and a molecular weight of 521.67 g/mol. Its IUPAC name is (2R,4R)-1-cyano-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-methyl-N-(4-phenylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-1-cyano-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-methyl-N-(4-phenylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167604512 |
| Molecular Formula | C32H35N5O2 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | (2R,4R)-1-cyano-N-[(1R)-2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]-4-methyl-N-(4-phenylphenyl)pyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1C[C@H](C(=O)N(c2ccc(-c3ccccc3)cc2)[C@@H](C(=O)NC2CCCCC2)c2cccnc2)N(C#N)C1 |
| InChI | InChI=1S/C32H35N5O2/c1-23-19-29(36(21-23)22-33)32(39)37(28-16-14-25(15-17-28)24-9-4-2-5-10-24)30(26-11-8-18-34-20-26)31(38)35-27-12-6-3-7-13-27/h2,4-5,8-11,14-18,20,23,27,29-30H,3,6-7,12-13,19,21H2,1H3,(H,35,38)/t23-,29-,30-/m1/s1 |
| InChIKey | KVKGWBKZMQQRCU-OENWMMNHSA-N |
| XLogP | 5.46 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|