C30H36N6O2 — CID 156893518
N-(4-tert-butylphenyl)-1,4-dicyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide (PubChem CID 156893518) has the molecular formula C30H36N6O2 and a molecular weight of 512.66 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1,4-dicyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-1,4-dicyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156893518 |
| Molecular Formula | C30H36N6O2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | N-(4-tert-butylphenyl)-1,4-dicyano-N-[2-(cyclohexylamino)-2-oxo-1-pyridin-3-ylethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(N(C(=O)C2CC(C#N)CN2C#N)C(C(=O)NC2CCCCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C30H36N6O2/c1-30(2,3)23-11-13-25(14-12-23)36(29(38)26-16-21(17-31)19-35(26)20-32)27(22-8-7-15-33-18-22)28(37)34-24-9-5-4-6-10-24/h7-8,11-15,18,21,24,26-27H,4-6,9-10,16,19H2,1-3H3,(H,34,37) |
| InChIKey | URECSMQHJMIRER-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|