C35H43N5O2 — CID 156893181
2-[4-tert-butyl-N-[(1-cyano-4-phenoxypyrrolidin-2-yl)methyl]anilino]-N-cyclohexyl-2-pyridin-3-ylacetamide (PubChem CID 156893181) has the molecular formula C35H43N5O2 and a molecular weight of 565.76 g/mol. Its IUPAC name is 2-[4-tert-butyl-N-[(1-cyano-4-phenoxypyrrolidin-2-yl)methyl]anilino]-N-cyclohexyl-2-pyridin-3-ylacetamide.
| Compound Name | 2-[4-tert-butyl-N-[(1-cyano-4-phenoxypyrrolidin-2-yl)methyl]anilino]-N-cyclohexyl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 156893181 |
| Molecular Formula | C35H43N5O2 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | 2-[4-tert-butyl-N-[(1-cyano-4-phenoxypyrrolidin-2-yl)methyl]anilino]-N-cyclohexyl-2-pyridin-3-ylacetamide |
| SMILES | CC(C)(C)c1ccc(N(CC2CC(Oc3ccccc3)CN2C#N)C(C(=O)NC2CCCCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C35H43N5O2/c1-35(2,3)27-16-18-29(19-17-27)40(23-30-21-32(24-39(30)25-36)42-31-14-8-5-9-15-31)33(26-11-10-20-37-22-26)34(41)38-28-12-6-4-7-13-28/h5,8-11,14-20,22,28,30,32-33H,4,6-7,12-13,21,23-24H2,1-3H3,(H,38,41) |
| InChIKey | XAYKTWNGSOGBDZ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|