C23H25Cl3N2O2 — CID 4230737
2-(5-chloro-N-(2-chloroacetyl)-2-methylanilino)-2-(4-chlorophenyl)-N-cyclohexylacetamide (PubChem CID 4230737) has the molecular formula C23H25Cl3N2O2 and a molecular weight of 467.82 g/mol. Its IUPAC name is 2-(5-chloro-N-(2-chloroacetyl)-2-methylanilino)-2-(4-chlorophenyl)-N-cyclohexylacetamide.
| Compound Name | 2-(5-chloro-N-(2-chloroacetyl)-2-methylanilino)-2-(4-chlorophenyl)-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 4230737 |
| Molecular Formula | C23H25Cl3N2O2 |
| Molecular Weight | 467.82 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 2-(5-chloro-N-(2-chloroacetyl)-2-methylanilino)-2-(4-chlorophenyl)-N-cyclohexylacetamide |
| SMILES | Cc1ccc(Cl)cc1N(C(=O)CCl)C(C(=O)NC1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H25Cl3N2O2/c1-15-7-10-18(26)13-20(15)28(21(29)14-24)22(16-8-11-17(25)12-9-16)23(30)27-19-5-3-2-4-6-19/h7-13,19,22H,2-6,14H2,1H3,(H,27,30) |
| InChIKey | VKEDKDPJPHNQJZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.82 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|