C25H30Cl2N2O4 — CID 99736633
(2S)-2-(N-(2-chloroacetyl)-2,4-dimethoxyanilino)-2-(4-chlorophenyl)-N-[(1S,2S)-2-methylcyclohexyl]acetamide (PubChem CID 99736633) has the molecular formula C25H30Cl2N2O4 and a molecular weight of 493.43 g/mol. Its IUPAC name is (2S)-2-(N-(2-chloroacetyl)-2,4-dimethoxyanilino)-2-(4-chlorophenyl)-N-[(1S,2S)-2-methylcyclohexyl]acetamide.
| Compound Name | (2S)-2-(N-(2-chloroacetyl)-2,4-dimethoxyanilino)-2-(4-chlorophenyl)-N-[(1S,2S)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 99736633 |
| Molecular Formula | C25H30Cl2N2O4 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (2S)-2-(N-(2-chloroacetyl)-2,4-dimethoxyanilino)-2-(4-chlorophenyl)-N-[(1S,2S)-2-methylcyclohexyl]acetamide |
| SMILES | COc1ccc(N(C(=O)CCl)[C@H](C(=O)N[C@H]2CCCC[C@@H]2C)c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H30Cl2N2O4/c1-16-6-4-5-7-20(16)28-25(31)24(17-8-10-18(27)11-9-17)29(23(30)15-26)21-13-12-19(32-2)14-22(21)33-3/h8-14,16,20,24H,4-7,15H2,1-3H3,(H,28,31)/t16-,20-,24-/m0/s1 |
| InChIKey | LVEFNMRRDZWWRR-YFBXQHAESA-N |
| XLogP | 5.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|