C24H27Cl3N2O2 — CID 100910111
(2S)-2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-2-(2-chlorophenyl)-N-[(1R,2R)-2-methylcyclohexyl]acetamide (PubChem CID 100910111) has the molecular formula C24H27Cl3N2O2 and a molecular weight of 481.85 g/mol. Its IUPAC name is (2S)-2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-2-(2-chlorophenyl)-N-[(1R,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | (2S)-2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-2-(2-chlorophenyl)-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 100910111 |
| Molecular Formula | C24H27Cl3N2O2 |
| Molecular Weight | 481.85 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | (2S)-2-[(2-chloroacetyl)-[(4-chlorophenyl)methyl]amino]-2-(2-chlorophenyl)-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)[C@H](c1ccccc1Cl)N(Cc1ccc(Cl)cc1)C(=O)CCl |
| InChI | InChI=1S/C24H27Cl3N2O2/c1-16-6-2-5-9-21(16)28-24(31)23(19-7-3-4-8-20(19)27)29(22(30)14-25)15-17-10-12-18(26)13-11-17/h3-4,7-8,10-13,16,21,23H,2,5-6,9,14-15H2,1H3,(H,28,31)/t16-,21-,23+/m1/s1 |
| InChIKey | CUHNQYISIRIYKE-VZPUWSDOSA-N |
| XLogP | 6.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.85 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|