C27H31Cl2N3O2 — CID 86809811
2-[(2-chloroacetyl)-[2-(1H-indol-3-yl)ethyl]amino]-2-(2-chlorophenyl)-N-(2-methylcyclohexyl)acetamide (PubChem CID 86809811) has the molecular formula C27H31Cl2N3O2 and a molecular weight of 500.47 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[2-(1H-indol-3-yl)ethyl]amino]-2-(2-chlorophenyl)-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[2-(1H-indol-3-yl)ethyl]amino]-2-(2-chlorophenyl)-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 86809811 |
| Molecular Formula | C27H31Cl2N3O2 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-[(2-chloroacetyl)-[2-(1H-indol-3-yl)ethyl]amino]-2-(2-chlorophenyl)-N-(2-methylcyclohexyl)acetamide |
| SMILES | CC1CCCCC1NC(=O)C(c1ccccc1Cl)N(CCc1c[nH]c2ccccc12)C(=O)CCl |
| InChI | InChI=1S/C27H31Cl2N3O2/c1-18-8-2-6-12-23(18)31-27(34)26(21-10-3-5-11-22(21)29)32(25(33)16-28)15-14-19-17-30-24-13-7-4-9-20(19)24/h3-5,7,9-11,13,17-18,23,26,30H,2,6,8,12,14-16H2,1H3,(H,31,34) |
| InChIKey | JCFWCPUOXNUXOZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|