C22H28N4O3 — CID 47003746
2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylcyclohexyl)propanamide (PubChem CID 47003746) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylcyclohexyl)propanamide.
| Compound Name | 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 47003746 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-(2-methylcyclohexyl)propanamide |
| SMILES | CC1CCCCC1NC(=O)C(C)N1C(=O)NC(Cc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C22H28N4O3/c1-13-7-3-5-9-17(13)24-20(27)14(2)26-21(28)19(25-22(26)29)11-15-12-23-18-10-6-4-8-16(15)18/h4,6,8,10,12-14,17,19,23H,3,5,7,9,11H2,1-2H3,(H,24,27)(H,25,29) |
| InChIKey | WUZLDZBOVZKGBY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|