C21H19ClN4O3 — CID 7917393
(2S)-N-(3-chlorophenyl)-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]propanamide (PubChem CID 7917393) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is (2S)-N-(3-chlorophenyl)-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]propanamide.
| Compound Name | (2S)-N-(3-chlorophenyl)-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 7917393 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (2S)-N-(3-chlorophenyl)-2-[(4S)-4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc(Cl)c1)N1C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C21H19ClN4O3/c1-12(19(27)24-15-6-4-5-14(22)10-15)26-20(28)18(25-21(26)29)9-13-11-23-17-8-3-2-7-16(13)17/h2-8,10-12,18,23H,9H2,1H3,(H,24,27)(H,25,29)/t12-,18-/m0/s1 |
| InChIKey | RYVYRDWGFOXICK-SGTLLEGYSA-N |
| XLogP | 3.31 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|