C22H22ClN3O2 — CID 113007151
N-(3-chlorophenyl)-1-[2-(1H-indol-3-yl)acetyl]piperidine-4-carboxamide (PubChem CID 113007151) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-[2-(1H-indol-3-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-1-[2-(1H-indol-3-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113007151 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-(3-chlorophenyl)-1-[2-(1H-indol-3-yl)acetyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C1CCN(C(=O)Cc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C22H22ClN3O2/c23-17-4-3-5-18(13-17)25-22(28)15-8-10-26(11-9-15)21(27)12-16-14-24-20-7-2-1-6-19(16)20/h1-7,13-15,24H,8-12H2,(H,25,28) |
| InChIKey | BOEACLQDITZVAS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |