C23H25N3O3 — CID 113007464
1-[2-(1H-indol-3-yl)acetyl]-N-(3-methoxyphenyl)piperidine-4-carboxamide (PubChem CID 113007464) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)acetyl]-N-(3-methoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(1H-indol-3-yl)acetyl]-N-(3-methoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113007464 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)acetyl]-N-(3-methoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1cccc(NC(=O)C2CCN(C(=O)Cc3c[nH]c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-29-19-6-4-5-18(14-19)25-23(28)16-9-11-26(12-10-16)22(27)13-17-15-24-21-8-3-2-7-20(17)21/h2-8,14-16,24H,9-13H2,1H3,(H,25,28) |
| InChIKey | OVQRGPLTVHODPA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |