C26H32Cl2N2O2 — CID 92912376
(2S)-2-[(2-chloroacetyl)-[2-(4-methylphenyl)ethyl]amino]-2-(2-chlorophenyl)-N-[(1R,2S)-2-methylcyclohexyl]acetamide (PubChem CID 92912376) has the molecular formula C26H32Cl2N2O2 and a molecular weight of 475.46 g/mol. Its IUPAC name is (2S)-2-[(2-chloroacetyl)-[2-(4-methylphenyl)ethyl]amino]-2-(2-chlorophenyl)-N-[(1R,2S)-2-methylcyclohexyl]acetamide.
| Compound Name | (2S)-2-[(2-chloroacetyl)-[2-(4-methylphenyl)ethyl]amino]-2-(2-chlorophenyl)-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 92912376 |
| Molecular Formula | C26H32Cl2N2O2 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (2S)-2-[(2-chloroacetyl)-[2-(4-methylphenyl)ethyl]amino]-2-(2-chlorophenyl)-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
| SMILES | Cc1ccc(CCN(C(=O)CCl)[C@H](C(=O)N[C@@H]2CCCC[C@@H]2C)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C26H32Cl2N2O2/c1-18-11-13-20(14-12-18)15-16-30(24(31)17-27)25(21-8-4-5-9-22(21)28)26(32)29-23-10-6-3-7-19(23)2/h4-5,8-9,11-14,19,23,25H,3,6-7,10,15-17H2,1-2H3,(H,29,32)/t19-,23+,25-/m0/s1 |
| InChIKey | FJOGJWYBWMGSJF-CYSDGLOUSA-N |
| XLogP | 5.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|