C27H35ClN2O2 — CID 86809877
2-[(2-chloroacetyl)-(2-phenylethyl)amino]-N-(2,3-dimethylcyclohexyl)-2-(4-methylphenyl)acetamide (PubChem CID 86809877) has the molecular formula C27H35ClN2O2 and a molecular weight of 455.04 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-(2-phenylethyl)amino]-N-(2,3-dimethylcyclohexyl)-2-(4-methylphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-(2-phenylethyl)amino]-N-(2,3-dimethylcyclohexyl)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 86809877 |
| Molecular Formula | C27H35ClN2O2 |
| Molecular Weight | 455.04 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 2-[(2-chloroacetyl)-(2-phenylethyl)amino]-N-(2,3-dimethylcyclohexyl)-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(C(=O)NC2CCCC(C)C2C)N(CCc2ccccc2)C(=O)CCl)cc1 |
| InChI | InChI=1S/C27H35ClN2O2/c1-19-12-14-23(15-13-19)26(27(32)29-24-11-7-8-20(2)21(24)3)30(25(31)18-28)17-16-22-9-5-4-6-10-22/h4-6,9-10,12-15,20-21,24,26H,7-8,11,16-18H2,1-3H3,(H,29,32) |
| InChIKey | CKZDQHONUCYXNB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.04 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|