C25H29Cl3N2O2 — CID 100910080
(2S)-2-[(2-chloroacetyl)-[2-(2-chlorophenyl)ethyl]amino]-2-(4-chlorophenyl)-N-[(1S,2R)-2-methylcyclohexyl]acetamide (PubChem CID 100910080) has the molecular formula C25H29Cl3N2O2 and a molecular weight of 495.88 g/mol. Its IUPAC name is (2S)-2-[(2-chloroacetyl)-[2-(2-chlorophenyl)ethyl]amino]-2-(4-chlorophenyl)-N-[(1S,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | (2S)-2-[(2-chloroacetyl)-[2-(2-chlorophenyl)ethyl]amino]-2-(4-chlorophenyl)-N-[(1S,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 100910080 |
| Molecular Formula | C25H29Cl3N2O2 |
| Molecular Weight | 495.88 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (2S)-2-[(2-chloroacetyl)-[2-(2-chlorophenyl)ethyl]amino]-2-(4-chlorophenyl)-N-[(1S,2R)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)[C@H](c1ccc(Cl)cc1)N(CCc1ccccc1Cl)C(=O)CCl |
| InChI | InChI=1S/C25H29Cl3N2O2/c1-17-6-2-5-9-22(17)29-25(32)24(19-10-12-20(27)13-11-19)30(23(31)16-26)15-14-18-7-3-4-8-21(18)28/h3-4,7-8,10-13,17,22,24H,2,5-6,9,14-16H2,1H3,(H,29,32)/t17-,22+,24+/m1/s1 |
| InChIKey | GVZMDHMDUGNGNW-UWSIMGETSA-N |
| XLogP | 6.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.88 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|