C16H24ClN2O+ — CID 4206046
[1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-dimethylazanium (PubChem CID 4206046) has the molecular formula C16H24ClN2O+ and a molecular weight of 295.83 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-dimethylazanium.
| Compound Name | [1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 4206046 |
| Molecular Formula | C16H24ClN2O+ |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | [1-(4-chlorophenyl)-2-(cyclohexylamino)-2-oxoethyl]-dimethylazanium |
| SMILES | C[NH+](C)C(C(=O)NC1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H23ClN2O/c1-19(2)15(12-8-10-13(17)11-9-12)16(20)18-14-6-4-3-5-7-14/h8-11,14-15H,3-7H2,1-2H3,(H,18,20)/p+1 |
| InChIKey | ZENAHZVLTRBGLM-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |