C17H24ClNO2 — CID 43388740
2-(4-chlorophenyl)-N-(4-hydroxycyclohexyl)-3-methylbutanamide (PubChem CID 43388740) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(4-hydroxycyclohexyl)-3-methylbutanamide.
| Compound Name | 2-(4-chlorophenyl)-N-(4-hydroxycyclohexyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 43388740 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(4-hydroxycyclohexyl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)NC1CCC(O)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H24ClNO2/c1-11(2)16(12-3-5-13(18)6-4-12)17(21)19-14-7-9-15(20)10-8-14/h3-6,11,14-16,20H,7-10H2,1-2H3,(H,19,21) |
| InChIKey | WUQCEVLWNGGVTG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |